Ethyldienolone: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation ( |
m Moving Category:Androgens and anabolic steroids to Category:Anabolic–androgenic steroids per Wikipedia:Categories for discussion/Log/2023 October 29#Category:Androgens and anabolic steroids |
||
(23 intermediate revisions by 16 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{chembox |
|||
{{Drugbox |
|||
⚫ | |||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
|ImageSize=200px |
|||
⚫ | |||
|IUPACName= |
|||
| IUPAC_name = (8S,13S,14S,17S)-17-ethyl-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|||
|OtherNames= |
|||
⚫ | |||
|Section1={{Chembox Identifiers |
|||
| alt = Skeletal formula of ethyldienolone |
|||
| CASNo= |
|||
| width = 250px |
|||
⚫ | |||
| image2 = Ethyldienolone 3D ball.png |
|||
| SMILES=CC14CCC2=C3CCC(=O)C=C3CCC2C4CCC1(O)CC |
|||
| alt2 = Ball-and-stick model of the ethyldienolone molecule |
|||
⚫ | |||
| width2 = 250px |
|||
|Section2={{Chembox Properties |
|||
| Formula=C<sub>20</sub>H<sub>28</sub>O<sub>2</sub> |
|||
| MolarMass=300.434 g/mol |
|||
| Appearance= |
|||
| Density= |
|||
| MeltingPt= |
|||
| BoilingPt= |
|||
| Solubility= |
|||
}} |
|||
|Section3={{Chembox Hazards |
|||
| MainHazards= |
|||
| FlashPt= |
|||
| Autoignition= |
|||
}} |
|||
}} |
|||
<!--Clinical data--> |
|||
'''Ethyldienolone''' is a drug which acts as an [[anabolic steroid]]. It is slightly more active than methyltestosterone when given orally.<ref>Edgren RA, Peterson DL, Jones RC, Nagra CL, Smith H, Hughes GA. ''Recent Progress in Hormone Research''. 1966;22:305.</ref> |
|||
| tradename = |
|||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|||
| pregnancy_US = <!-- A / B / C / D / X --> |
|||
| pregnancy_category = |
|||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|||
| legal_CA = |
|||
| legal_UK = |
|||
| legal_US = |
|||
| legal_status = |
|||
| routes_of_administration = [[Oral administration|By mouth]] |
|||
<!--Pharmacokinetic data--> |
|||
| bioavailability = |
|||
| protein_bound = |
|||
| metabolism = |
|||
| elimination_half-life = |
|||
| excretion = |
|||
<!-- Identifiers --> |
|||
| CAS_number_Ref = |
|||
| CAS_number = |
|||
| CAS_supplemental = |
|||
| ATC_prefix = |
|||
| ATC_suffix = |
|||
| ATC_supplemental = |
|||
⚫ | |||
| IUPHAR_ligand = |
|||
| DrugBank_Ref = |
|||
| DrugBank = |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 34993055 |
|||
| UNII = PHW6P6I5H7 |
|||
| KEGG = |
|||
| ChEBI = |
|||
| ChEMBL = |
|||
| synonyms = 17α-Methyl-19-nor-δ<sup>9</sup>-testosterone; 17α-Methylestra-4,9-dien-17β-ol-3-one |
|||
<!--Chemical data--> |
|||
| C=20 | H=28 | O=2 |
|||
| SMILES = CC[C@@]1(CC[C@@H]2[C@@H]1CCC3=C4CCC(=O)C=C4CC[C@@H]23)O |
|||
| StdInChI_Ref = |
|||
| StdInChI = 1S/C19H26O2/c1-2-19(21)10-9-17-16-5-3-12-11-13(20)4-6-14(12)15(16)7-8-18(17)19/h11,16-18,21H,2-10H2,1H3/t16-,17+,18+,19+/m1/s1 |
|||
| StdInChIKey_Ref = |
|||
| StdInChIKey = MPJHQVVZUHVQJF-XWSJACJDSA-N |
|||
⚫ | |||
'''Ethyldienolone''', also known as '''17α-methyl-19-nor-δ<sup>9</sup>-testosterone''', as well as '''17α-methylestra-4,9-dien-17β-ol-3-one''', is [[synthetic compound|synthetic]], [[oral administration|orally active]] [[anabolic-androgenic steroid]] (AAS) and a [[17α-alkylated anabolic steroid|17α-alkylated]] [[chemical derivative|derivative]] of [[19-nortestosterone]]. It is slightly more active than [[methyltestosterone]] when given orally.<ref>{{cite journal | vauthors = Edgren RA, Peterson DL, Jones RC, Nagra CL, Smith H, Hughes GA | title = Biological effects of synthetic gonanes | journal = Recent Progress in Hormone Research | volume = 22 | pages = 305–49 | date = 1966 | pmid = 5334628 | doi = 10.1016/b978-1-4831-9825-5.50011-7 | isbn = 978-1-4831-9825-5 }}</ref> Ethyldienolone is closely related to [[dienolone]] and [[methyldienolone]]. |
|||
== |
==== |
||
* [[Dienedione]] |
|||
{{reflist}} |
|||
* [[Metribolone]] |
|||
== References == |
|||
{{Anabolic steroids}} |
|||
{{Reflist}} |
|||
{{Androgen receptor modulators}} |
|||
⚫ | |||
[[Category:Anabolic–androgenic steroids]] |
|||
⚫ | |||
[[Category:Estranes]] |
|||
[[Category:Hepatotoxins]] |
|||
{{ |
{{-stub}} |
||
{{Genito-urinary-drug-stub}} |