Jump to content

Ethyldienolone: Difference between revisions

Content deleted Content added
CheMoBot (talk | contribs)
Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (
 
(23 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{chembox
{{Drugbox
| verifiedrevid = 376094481
| Verifiedfields = changed
|ImageFile=Ethyldienolone.png
| Watchedfields = changed
|ImageSize=200px
| verifiedrevid =
|IUPACName=
| IUPAC_name = (8S,13S,14S,17S)-17-ethyl-17-hydroxy-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one
|OtherNames=
|=Ethyldienolone.
|Section1={{Chembox Identifiers
| alt = Skeletal formula of ethyldienolone
| CASNo=
| width = 250px
| PubChem=
| image2 = Ethyldienolone 3D ball.png
| SMILES=CC14CCC2=C3CCC(=O)C=C3CCC2C4CCC1(O)CC
| alt2 = Ball-and-stick model of the ethyldienolone molecule
}}
| width2 = 250px
|Section2={{Chembox Properties
| Formula=C<sub>20</sub>H<sub>28</sub>O<sub>2</sub>
| MolarMass=300.434 g/mol
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| Autoignition=
}}
}}


<!--Clinical data-->
'''Ethyldienolone''' is a drug which acts as an [[anabolic steroid]]. It is slightly more active than methyltestosterone when given orally.<ref>Edgren RA, Peterson DL, Jones RC, Nagra CL, Smith H, Hughes GA. ''Recent Progress in Hormone Research''. 1966;22:305.</ref>
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = [[Oral administration|By mouth]]

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!-- Identifiers -->
| CAS_number_Ref =
| CAS_number =
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem=
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 34993055
| UNII = PHW6P6I5H7
| KEGG =
| ChEBI =
| ChEMBL =
| synonyms = 17α-Methyl-19-nor-δ<sup>9</sup>-testosterone; 17α-Methylestra-4,9-dien-17β-ol-3-one

<!--Chemical data-->
| C=20 | H=28 | O=2
| SMILES = CC[C@@]1(CC[C@@H]2[C@@H]1CCC3=C4CCC(=O)C=C4CC[C@@H]23)O
| StdInChI_Ref =
| StdInChI = 1S/C19H26O2/c1-2-19(21)10-9-17-16-5-3-12-11-13(20)4-6-14(12)15(16)7-8-18(17)19/h11,16-18,21H,2-10H2,1H3/t16-,17+,18+,19+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = MPJHQVVZUHVQJF-XWSJACJDSA-N
}}


'''Ethyldienolone''', also known as '''17α-methyl-19-nor-δ<sup>9</sup>-testosterone''', as well as '''17α-methylestra-4,9-dien-17β-ol-3-one''', is [[synthetic compound|synthetic]], [[oral administration|orally active]] [[anabolic-androgenic steroid]] (AAS) and a [[17α-alkylated anabolic steroid|17α-alkylated]] [[chemical derivative|derivative]] of [[19-nortestosterone]]. It is slightly more active than [[methyltestosterone]] when given orally.<ref>{{cite journal | vauthors = Edgren RA, Peterson DL, Jones RC, Nagra CL, Smith H, Hughes GA | title = Biological effects of synthetic gonanes | journal = Recent Progress in Hormone Research | volume = 22 | pages = 305–49 | date = 1966 | pmid = 5334628 | doi = 10.1016/b978-1-4831-9825-5.50011-7 | isbn = 978-1-4831-9825-5 }}</ref> Ethyldienolone is closely related to [[dienolone]] and [[methyldienolone]].


==References==
====
* [[Dienedione]]
{{reflist}}
* [[Metribolone]]


== References ==
{{Anabolic steroids}}
{{Reflist}}


{{Androgen receptor modulators}}
[[Category:Steroids]]


[[Category:Anabolic–androgenic steroids]]
[[Category:]]
[[Category:Estranes]]
[[Category:Hepatotoxins]]


{{gastrointestinal-drug-stub}}
{{-stub}}
{{Genito-urinary-drug-stub}}